kadijahhmansaray kadijahhmansaray

31-05-2024
History

contestada

Which of the following are Indians NOT likely to eat?

Soup

Rice

Beef

Curry

Respuesta :

nidhinandwani2011 nidhinandwani2011

31-05-2024

Indian are not likely to eat beef, reason being they are mostly vegetarian

Answer Link

Otras preguntas

The pH scale is a mathematical indicator of the Select one: A. concentration of H+ present in a solution. B. ability to dissolve in water. C. total amount of al

Determine the number of protons and the number of electrons in each ion. a. Al3+ b. Se2- c. Ga3+ d. Sr2+

Judy Michaels couldn't believe the luck she was having. First she found a $20 bill on the sidewalk. Then her boss gave her the raise she deservedly asked for. A

If a motor uses 16 W of power to exert a force of 12,000 N to lift an elevator 8 m, how much time did it take the elevator?

why do you think Athenians made this rule? hint think about their government experiences before democracy

Which structure predominates in the white matter of the brain? a. myelinated axons b. neuronal cell bodies c. ganglia of the parasympathetic nerves d. bundles o

Which of the following is not a management function? Select one: a. Controlling b. Directing c. Planning d. Constraining

Rank the following carbocations in order of decreasing stability. most stable least stable[C+]C(=C)C1CCCCC1[C+]C1CCCCC1C[C+]1CCCCC1

!- Klo3 Cocl2, 2-KIO3 Naoh, 3- Naoh [tex]\mathrm{CoCl} 2[/tex] Molecular, complete net ionic, net lonic. Please write all the three. please include the net ioni

How step to be Jenius?