pxrnstar1398 pxrnstar1398

28-04-2022
Biology

contestada

Which biogeochemical cycle does not include a major path in which the substance cycles through the atmosphere?.

Respuesta :

akimcf5279 akimcf5279

28-04-2022

Answer:

phosphorus cycle.

Explanation:

Answer Link

Otras preguntas

eliminate the parameter and write the corresponding rectangular equation whose graph represents the curvex=1+costhetay=1+2sintheta

Suppose a normal distribution has a mean of 266 and a standard deviation of12. What is P(x >= 242)

Find the domain and range of each relation. Determine if the relation is a function .

What is the molarity of a solution made using 2.08 g of KI dissolved in enough water to make 279 mL of solution?

Write a recursive sequence that represents the sequence defined by the following explicit formula: an = x + 4xn

Please help that very important for me Dilation is a transformation in which an image is usually ____ or____ depending on the _____ in such a way that the angle

use x = 1 to identify the value of each expression

Note: Triangle may not be drawn to scale.Suppose a=48 and b=55 and c=73.sec(B)=csc(B)=cot(B)=

what is the answer1-m=6-6m

u can start immediately I already got the answer I just need to see if i got it right and understand