kkslider5 kkslider5

26-09-2022
Mathematics

contestada

-7ab(xa^9+ya^3-8) = ?
please multiply and put it in standard form for the answer :)

Respuesta :

Otras preguntas

How does the Lewis structure of Mg(OH)2 differ from the hydronium (H3O+) ion that it reacts with?

Determine the electron geometry (eg) and molecular geometry (mg) of ICl₂⁻

analisando o excerto do texto: “…se constatada a necessidade de aparelhos…”, a palavra destacada pode ser substituída, sem alteração de sentido, por:

What is the solution to the equation One-fourth x minus one-eighth = Start Fraction 7 Over 8 End Fraction + one-half x? x = negative 5 x = negative 4 x = 4 x =

Express 0.00382 x 0.50 in scientific notation

Identify the expected major product of the following reaction. [tex]\underset{\mathrm{H}_3 \mathrm{O}^{+}}{\longrightarrow}[/tex] ?CC(C)C(C)(O)COCC(O)C(C)(C)OCC

18. List some hate/terrorist groups that were created during redemption. What were their purpose?

a time the difference of 9 and 6 is divided by the product of two and four

Identify three types of scientists who could be called upon to investigate the nuclear leak. Why would these scientists be helpful in determining if, and how mu

A geometric sequence has a first term 3 and a common ratio of 2. Determine the partial sum of the first 10 terms. Answers: (A) -3,069 (B) 3,069 (C) 59,048 (D) 1